Approval: | ISO |
---|---|
IUPAC PIN: | (2,4,5-trichlorophenoxy)acetic acid |
IUPAC name: | (2,4,5-trichlorophenoxy)acetic acid |
CAS name: | 2-(2,4,5-trichlorophenoxy)acetic acid |
CAS Reg. No.: | 93-76-5 |
Formula: | C8H5Cl3O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example 2,4,5-T-butometyl [7173-98-0], 2,4,5-T-butotyl [2545-59-7], 2,4,5-T-butyl [93-79-8], 2,4,5-T-doboxyl [3084-62-6], 2,4,5-T-etexyl [1928-47-8], 2,4,5-T-isobutyl [4938-72-1], 2,4,5-T-isoctyl [25168-15-4], 2,4,5-T-isopropyl [93-78-7], 2,4,5-T-methyl [1928-37-6], 2,4,5-T-pentyl [120-39-8], 2,4,5-T-sodium [13560-99-1], 2,4,5-T-terboxyl [1928-48-9], 2,4,5-T-triethylammonium [2008-46-0], 2,4,5-T-trolamine [3813-14-7]. |
Structure: | |
Pronunciation: | too for fīv tē Guide to British pronunciation |
InChIKey: | SMYMJHWAQXWPDB-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names