| Approval: | ISO |
|---|---|
| IUPAC PIN: | 4-(2,4,5-trichlorophenoxy)butanoic acid |
| IUPAC name: | 4-(2,4,5-trichlorophenoxy)butanoic acid 1979 Rules: 4-(2,4,5-trichlorophenoxy)butyric acid |
| CAS name: | 4-(2,4,5-trichlorophenoxy)butanoic acid |
| CAS Reg. No.: | 93-80-1 |
| Formula: | C10H9Cl3O3 |
| Activity: | herbicides (phenoxybutyric) |
| Notes: | |
| Structure: | |
| Pronunciation: | too for fīv tē bē Guide to British pronunciation |
| InChIKey: | RTWCZQFXFMXXKP-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H9Cl3O3/c11-6-4-8(13)9(5-7(6)12)16-3-1-2-10(14)15/h4-5H,1-3H2,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names