| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | N-(3-methylbut-2-en-1-yl)-7H-purin-6-amine |
| IUPAC name: | N-(3-methylbut-2-enyl)-7H-purin-6-amine 1979 Rules: N-(3-methylbut-2-enyl)adenine |
| CAS name: | N-(3-methyl-2-buten-1-yl)-1H-purin-6-amine |
| CAS Reg. No.: | 2365-40-4 |
| Formula: | C10H13N5 |
| Activity: | plant growth regulators (cytokinin) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. The name “enadenine” (烯腺嘌呤) is approved in China. Also known as 6-isopentenyladenine and 6-isopentenylaminopurine. |
| Structure: | |
| Pronunciation: | too ī pē Guide to British pronunciation |
| InChIKey: | HYVABZIGRDEKCD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13N5/c1-7(2)3-4-11-9-8-10(13-5-12-8)15-6-14-9/h3,5-6H,4H2,1-2H3,(H2,11,12,13,14,15) |
A data sheet from the Compendium of Pesticide Common Names