Approval: | WSSA |
---|---|
IUPAC PIN: | (3,4-dichlorophenoxy)acetic acid |
IUPAC name: | (3,4-dichlorophenoxy)acetic acid |
CAS name: | 2-(3,4-dichlorophenoxy)acetic acid |
CAS Reg. No.: | 588-22-7 |
Formula: | C8H6Cl2O3 |
Activity: | herbicides (phenoxyacetic) |
Notes: | There is no ISO common name for this substance; the name “3,4-DA” is approved by the Weed Science Society of America. |
Structure: | |
Pronunciation: | thrē for dē ā Guide to British pronunciation |
InChIKey: | SNYRXHULAWEECU-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O3/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
A data sheet from the Compendium of Pesticide Common Names