Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | 1-aminocyclopropane-1-carboxylic acid |
IUPAC name: | 1-aminocyclopropanecarboxylic acid |
CAS name: | 1-aminocyclopropanecarboxylic acid |
CAS Reg. No.: | 22059-21-8 |
Formula: | C4H7NO2 |
Activity: | plant growth regulators (ethylene releaser) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | ā sē sē Guide to British pronunciation |
InChIKey: | PAJPWUMXBYXFCZ-UHFFFAOYSA-N |
InChI: | InChI=1S/C4H7NO2/c5-4(1-2-4)3(6)7/h1-2,5H2,(H,6,7) |
A data sheet from the Compendium of Pesticide Common Names