| Approval: | USSR |
|---|---|
| IUPAC PIN: | 1-[(hexyloxy)methyl]azepan-2-one |
| IUPAC name: | N-[(hexyloxy)methyl]hexano-6-lactam 1979 rules: N-[(hexyloxy)methyl]-ε-caprolactam |
| CAS name: | 1-[(hexyloxy)methyl]hexahydro-2H-azepin-2-one |
| CAS Reg. No.: | |
| Formula: | C13H25NO2 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “acrep” (акреп) was used in the former USSR. |
| Structure: | |
| Pronunciation: | ǎk-krěp Guide to British pronunciation |
| InChIKey: | IXCJFHRRPLTTSW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H25NO2/c1-2-3-4-8-11-16-12-14-10-7-5-6-9-13(14)15/h2-12H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names