| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2-chloro-N,N-di(prop-2-en-1-yl)acetamide |
| IUPAC name: | N,N-diallyl-2-chloroacetamide |
| CAS name: | 2-chloro-N,N-di-2-propen-1-ylacetamide |
| CAS Reg. No.: | 93-71-0 |
| Formula: | C8H12ClNO |
| Activity: | herbicides (chloroacetamide) |
| Notes: | The name “CDAA” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | ǎl-līd-ō-klor Guide to British pronunciation |
| InChIKey: | MDBGGTQNNUOQRC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H12ClNO/c1-3-5-10(6-4-2)8(11)7-9/h3-4H,1-2,5-7H2 |
A data sheet from the Compendium of Pesticide Common Names