| Approval: | ISO common name not required |
|---|---|
| IUPAC name: | (3aR,4R,5R,6S,6aS)-2-(dimethylamino)-4,5,6,6a-tetrahydro-4-hydroxy-6-(hydroxymethyl)-3aH-cyclopenta[d][1,3]oxazol-5-yl 2-acetamido-4-O-(2-acetamido-2-deoxy-β-D-allopyranosyl)-2-deoxy-β-D-allopyranoside |
| CAS name: | (3aR,4R,5R,6S,6aS)-2-(dimethylamino)-3a,5,6,6a-tetrahydro-4-hydroxy-6-(hydroxymethyl)-4H-cyclopentoxazol-5-yl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-β-D-allopyranosyl]-2-deoxy-β-D-allopyranoside |
| CAS Reg. No.: | 103782-08-7 |
| Formula: | C25H42N4O14 |
| Activity: | insecticides (antibiotic) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | ǎl-lōs-a-mī-dǐn Guide to British pronunciation |
| InChIKey: | MDWNFWDBQGOKNZ-XYUDZHFQSA-N |
| InChI: | InChI=1S/C25H42N4O14/c1-8(33)26-14-17(36)16(35)11(6-31)39-23(14)42-22-12(7-32)40-24(15(19(22)38)27-9(2)34)41-21-10(5-30)20-13(18(21)37)28-25(43-20)29(3)4/h10-24,30-32,35-38H,5-7H2,1-4H3,(H,26,33)(H,27,34)/t10-,11+,12+,13+,14+,15+,16+,17-,18+,19-,20-,21+,22+,23-,24-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names