| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| IUPAC name: | N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| CAS name: | N2,N2,N4,N4,N6,N6-hexamethyl-1,3,5-triazine-2,4,6-triamine |
| CAS Reg. No.: | 645-05-6 |
| Formula: | C9H18N6 |
| Activity: | chemosterilants |
| Notes: | There is no ISO common name for this substance; the name “altretamine” is approved by the World Health Organization. The name “hemel” is approved by the Entomological Society of America. |
| Structure: |  |
| Pronunciation: | ǎl-trět-a-mēn Guide to British pronunciation |
| InChIKey: | UUVWYPNAQBNQJQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H18N6/c1-13(2)7-10-8(14(3)4)12-9(11-7)15(5)6/h1-6H3 |