| Approval: | China |
|---|---|
| IUPAC PIN: | 2-amino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| IUPAC name: | 2-amino-4-methylthiazole-5-carboxanilide |
| CAS name: | 2-amino-4-methyl-N-phenyl-5-thiazolecarboxamide |
| CAS Reg. No.: | 21452-14-2 |
| Formula: | C11H11N3OS |
| Activity: | bactericides |
| Notes: | There is no ISO common name for this substance; the name “amicarthiazol” (拌种灵) is approved in China. |
| Structure: | |
| Pronunciation: | ǎm-ǐ-kar-thī-a-zǒl Guide to British pronunciation |
| InChIKey: | CACOMUHPQMDEJQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H11N3OS/c1-7-9(16-11(12)13-7)10(15)14-8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,13)(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names