Status: | ISO 1750 (approved) |
---|---|
IUPAC PIN: | N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)-4-methoxybenzamide |
IUPAC name: | N-(3,4-dichlorophenyl)-N-(dimethylcarbamoyl)-4-methoxybenzamide 1979 Rules: 1-(p-anisoyl)-1-(3,4-dichlorophenyl)-3,3-dimethylurea |
CAS name: | N-(3,4-dichlorophenyl)-N-[(dimethylamino)carbonyl]-4-methoxybenzamide |
CAS Reg. No.: | 2689-43-2 |
Formula: | C17H16Cl2N2O3 |
Activity: | herbicides (phenylurea) |
Notes: | The name “anisuron” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | ǎ-nǐs-ūr-ǒn Guide to British pronunciation |
InChIKey: | RGKLVVDHWRAWRO-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H16Cl2N2O3/c1-20(2)17(23)21(12-6-9-14(18)15(19)10-12)16(22)11-4-7-13(24-3)8-5-11/h4-10H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names