| Status: | ISO 1750 (published) |
|---|---|
| IUPAC name: | (E)-L-2-[2-(2-aminoethoxy)vinyl]glycine or (2S,3E)-2-amino-4-(2-aminoethoxy)but-3-enoic acid |
| CAS name: | (2S,3E)-2-amino-4-(2-aminoethoxy)-3-butenoic acid |
| CAS Reg. No.: | 49669-74-1 |
| Formula: | C6H12N2O3 |
| Activity: | plant growth regulators (ethylene inhibitor) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example aviglycine hydrochloride [55720-26-8]. The name “AVG” has been used in the literature, but it has no official status. |
| Structure: |  |
| Pronunciation: | ǎv-ǐ-glī-sēn Guide to British pronunciation |
| InChIKey: | USGUVNUTPWXWBA-JRIXXDKMSA-N |
| InChI: | InChI=1S/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1 |