| Approval: | WSSA |
|---|---|
| IUPAC PIN: | rac-(2R)-butan-2-yl (3-chlorophenyl)carbamate |
| IUPAC name: | (2RS)-butan-2-yl (3-chlorophenyl)carbamate 1979 Rules: (RS)-sec-butyl 3-chlorocarbanilate |
| CAS name: | 1-methylpropyl N-(3-chlorophenyl)carbamate |
| CAS Reg. No.: | 2164-13-8 |
| Formula: | C11H14ClNO2 |
| Activity: | herbicides (carbamate) |
| Notes: | There is no ISO common name for this substance; the name “BCPC” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | bē sē pē sē Guide to British pronunciation |
| InChIKey: | CURLHBZYTFVCRG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H14ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h4-8H,3H2,1-2H3,(H,13,14) |