| Approval: | ISO |
|---|---|
| IUPAC PIN: | benzoic (Ξ)-3-chloro-N-ethoxy-2,6-dimethoxybenzene-1-carboximidic anhydride |
| IUPAC name: | benzoic (EZ)-3-chloro-N-ethoxy-2,6-dimethoxybenzenecarboximidic anhydride |
| CAS name: | benzoic acid anhydride with 3-chloro-N-ethoxy-2,6-dimethoxybenzenecarboximidic acid |
| CAS Reg. No.: | 29104-30-1 |
| Formula: | C18H18ClNO5 |
| Activity: | acaricides (unclassified) |
| Notes: | The name “benzomate” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | |
| Pronunciation: | běnz-ǒks-ǐ-māt Guide to British pronunciation |
| InChIKey: | BZMIHNKNQJJVRO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H18ClNO5/c1-4-24-20-17(25-18(21)12-8-6-5-7-9-12)15-14(22-2)11-10-13(19)16(15)23-3/h5-11H,4H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names