| Status: | ISO 1750 (published) |
|---|---|
| IUPAC name: | N-benzoyl-N-(3,4-dichlorophenyl)-DL-alanine |
| CAS name: | N-benzoyl-N-(3,4-dichlorophenyl)-DL-alanine |
| CAS Reg. No.: | 22212-56-2 |
| Formula: | C16H13Cl2NO3 |
| Activity: | herbicides (arylaminopropionic acid) |
| Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example benzoylprop-ethyl [22212-55-1]. The name “benzoylprop-ethyl” was formerly approved by ISO for the ethyl ester, but it was replaced by the name “benzoylprop” for the acid as part of a rationalisation exercise in 1989. |
| Structure: |  |
| Pronunciation: | běn-zō-īl-prǒp Guide to British pronunciation |
| InChIKey: | WZZRJCUYSKKFHO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H13Cl2NO3/c1-10(16(21)22)19(12-7-8-13(17)14(18)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22) |