| Approval: | China |
|---|---|
| IUPAC PIN: | ethyl (2Ξ)-2-cyano-3-(methylsulfanyl)-3-(2-nitroanilino)prop-2-enoate |
| IUPAC name: | ethyl (2EZ)-2-cyano-3-(methylthio)-3-(2-nitroanilino)prop-2-enoate 1979 Rules: ethyl (2EZ)-2-cyano-3-(methylthio)-3-(2-nitroanilino)acrylate |
| CAS name: | ethyl 2-cyano-3-(methylthio)-3-[(2-nitrophenyl)amino]-2-propenoate |
| CAS Reg. No.: | 226703-69-1 |
| Formula: | C13H13N3O4S |
| Activity: | virucides |
| Notes: | There is no ISO common name for this substance; the name “bingqingxiao” (病氰硝) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | HDHSBOLYUDZKFK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H13N3O4S/c1-3-20-13(17)9(8-14)12(21-2)15-10-6-4-5-7-11(10)16(18)19/h4-7,15H,3H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names