| Approval: | ESA |
|---|---|
| IUPAC PIN: | (5-benzylfuran-3-yl)methyl (1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| IUPAC name: | (5-benzyl-3-furyl)methyl (1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropanecarboxylate Rothamsted-style stereodescriptors: (5-benzyl-3-furyl)methyl (1R)-trans-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS name: | [5-(phenylmethyl)-3-furanyl]methyl (1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS Reg. No.: | 22431-62-5 |
| Formula: | C24H28O3 |
| Activity: | insecticides (pyrethroid) |
| Notes: | There is no ISO common name for this substance; the name “bioethanomethrin” is approved by the Entomological Society of America. |
| Structure: | |
| Pronunciation: | bī-ō-ěth-a-nō-mēth-rǐn Guide to British pronunciation |
| InChIKey: | MGRRXBWTLBJEMS-YADHBBJMSA-N |
| InChI: | InChI=1S/C24H28O3/c1-24(2)21(14-18-10-6-7-11-18)22(24)23(25)27-16-19-13-20(26-15-19)12-17-8-4-3-5-9-17/h3-5,8-9,13-15,21-22H,6-7,10-12,16H2,1-2H3/t21-,22+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names