| Approval: | ISO preferred name |
|---|---|
| IUPAC name: | boric acid 2005 Rules: trihydroxidoboron |
| CAS name: | boric acid (H3BO3) |
| CAS Reg. No.: | 10043-35-3 |
| Formula: | BH3O3 |
| Activity: | (inorganic) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | bor-ǐk ǎs-ǐd Guide to British pronunciation |
| InChIKey: | KGBXLFKZBHKPEV-UHFFFAOYSA-N |
| InChI: | InChI=1S/BH3O3/c2-1(3)4/h2-4H |
A data sheet from the Compendium of Pesticide Common Names