| Approval: | China |
|---|---|
| IUPAC PIN: | (Ξ)-[3-(4-bromophenoxy)phenyl](cyano)methyl (2Ξ)-2-[4-(difluoromethoxy)phenyl]-3-methylbutanoate |
| IUPAC name: | (αRS)-3-(4-bromophenoxy)-α-cyanobenzyl (2RS)-2-[4-(difluoromethoxy)phenyl]-3-methylbutyrate |
| CAS name: | [3-(4-bromophenoxy)phenyl]cyanomethyl 4-(difluoromethoxy)-α-(1-methylethyl)benzeneacetate |
| CAS Reg. No.: | 160791-64-0 |
| Formula: | C26H22BrF2NO4 |
| Activity: | acaricides (pyrethroid isovalerate ester) insecticides (pyrethroid isovalerate ester) |
| Notes: | There is no ISO common name for this substance; the name “brofluthrinate” (溴氟菊酯) is approved in China. The name “flubrocythrinate” has been used in the literature, but it has no official approval. The 3-phenoxyphenyl moiety is incorrectly shown as 2-phenoxyphenyl in GB 4839-2009 Chinese common names for pesticides. |
| Structure: | |
| Pronunciation: | brō-floo-thrǐn-āt Guide to British pronunciation |
| InChIKey: | BUHNCQOJJZAOMJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C26H22BrF2NO4/c1-16(2)24(17-6-10-21(11-7-17)33-26(28)29)25(31)34-23(15-30)18-4-3-5-22(14-18)32-20-12-8-19(27)9-13-20/h3-14,16,23-24,26H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names