| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | N-bromoacetamide |
| IUPAC name: | N-bromoacetamide |
| CAS name: | N-bromoacetamide |
| CAS Reg. No.: | 79-15-2 |
| Formula: | C2H4BrNO |
| Activity: | molluscicides |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | brō-mō-a-sēt-a-mīd Guide to British pronunciation |
| InChIKey: | VBTQNRFWXBXZQR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
A data sheet from the Compendium of Pesticide Common Names