| Approval: | none |
|---|---|
| IUPAC PIN: | 1-isothiocyanato-4-(4-nitrophenoxy)benzene |
| IUPAC name: | 4-(4-nitrophenoxy)phenyl isothiocyanate |
| CAS name: | 1-isothiocyanato-4-(4-nitrophenoxy)benzene |
| CAS Reg. No.: | 19881-18-6 |
| Formula: | C13H8N2O3S |
| Activity: | anthelmintic |
| Notes: | The name “cantrodifene” has been used in the literature, but it has no official approval. The name “nitroscanate” is approved by the World Health Organization. |
| Structure: |  |
| Pronunciation: | kǎn-trō-dī-fēn Guide to British pronunciation |
| InChIKey: | SVMGVZLUIWGYPH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H8N2O3S/c16-15(17)11-3-7-13(8-4-11)18-12-5-1-10(2-6-12)14-9-19/h1-8H |