| Approval: | WSSA |
|---|---|
| IUPAC PIN: | 2-chloro-N,N-diethylacetamide |
| IUPAC name: | 2-chloro-N,N-diethylacetamide |
| CAS name: | 2-chloro-N,N-diethylacetamide |
| CAS Reg. No.: | 2315-36-8 |
| Formula: | C6H12ClNO |
| Activity: | herbicides (chloroacetamide) |
| Notes: | There is no ISO common name for this substance; the name “CDEA” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | sē dē ē ā Guide to British pronunciation |
| InChIKey: | CQQUWTMMFMJEFE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H12ClNO/c1-3-8(4-2)6(9)5-7/h3-5H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names