| Approval: | none |
|---|---|
| IUPAC PIN: | mixture of ethyl (1Ξ,2Ξ,4Ξ)-4-iodo-2-methylcyclohexane-1-carboxylate and ethyl (1Ξ,2Ξ,5Ξ)-5-iodo-2-methylcyclohexane-1-carboxylate |
| IUPAC name: | ethyl (±)-4(or 5)-iodo-2-methylcyclohexanecarboxylate |
| CAS name: | ethyl 4(or 5)-iodo-2-methyl-1-cyclohexanecarboxylate |
| CAS Reg. No.: | 160016-46-6 |
| Formula: | C10H17IO2 |
| Activity: | insect attractants (Dipteran) |
| Notes: | There is no ISO common name for this substance; the name “ceralure” has been used in the literature but it has no official approval. This substance is named after the insect that it is used to attract, the Mediterranean fruit fly Ceratitis capitata (Wiedemann) (Tephritidae, Diptera). |
| Structure: | |
| Pronunciation: | sěr-a-lūr Guide to British pronunciation |
| InChIKey: | 4-iodo isomer: VCYRCZHXDDPHQG-UHFFFAOYSA-N 5-iodo isomer: JPBJPDNMZHDUCD-UHFFFAOYSA-N identifier for mixture (not valid): HPZFFZCACVGEID-UHFFFAOYSA-N |
| InChI: | 4-iodo isomer: InChI=1S/C10H17IO2/c1-3-13-10(12)9-5-4-8(11)6-7(9)2/h7-9H,3-6H2,1-2H3 5-iodo isomer: InChI=1S/C10H17IO2/c1-3-13-10(12)9-6-8(11)5-4-7(9)2/h7-9H,3-6H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names