Approval | ISO |
---|---|
IUPAC PIN: | 6-chloro-N2,N2,N4,N4-tetraethyl-1,3,5-triazine-2,4-diamine |
IUPAC name: | 6-chloro-N2,N2,N4,N4-tetraethyl-1,3,5-triazine-2,4-diamine |
CAS name: | 6-chloro-N2,N2,N4,N4-tetraethyl-1,3,5-triazine-2,4-diamine |
CAS Reg. No.: | 580-48-3 |
Formula: | C11H20ClN5 |
Activity: | herbicides (chlorotriazine) |
Notes: | The name “chlorazine” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | klor-a-zēn Guide to British pronunciation |
InChIKey: | QHXDTLYEHWXDSO-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H20ClN5/c1-5-16(6-2)10-13-9(12)14-11(15-10)17(7-3)8-4/h5-8H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names