| Approval: | China |
|---|---|
| IUPAC PIN: | N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitroaniline |
| IUPAC name: | N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitroaniline 1979 Rules: N,N-bis(2-chloroethyl)-2,6-dinitro-p-toluidine |
| CAS name: | N,N-bis(2-chloroethyl)-4-methyl-2,6-dinitrobenzenamine |
| CAS Reg. No.: | 26389-78-6 |
| Formula: | C11H13Cl2N3O4 |
| Activity: | herbicides (dinitroaniline) |
| Notes: | There is no ISO common name for this substance; the name “chlornidine” (氯乙灵) is approved in China. |
| Structure: | |
| Pronunciation: | klor-nǐ-dēn Guide to British pronunciation |
| InChIKey: | XKUWFOYPQIVFMM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H13Cl2N3O4/c1-8-6-9(15(17)18)11(10(7-8)16(19)20)14(4-2-12)5-3-13/h6-7H,2-5H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names