| Approval: | ISO |
|---|---|
| IUPAC PIN: | N′-(3-chloro-4-methylphenyl)-N,N-dimethylurea |
| IUPAC name: | 3-(3-chloro-4-methylphenyl)-1,1-dimethylurea 1979 Rules: 3-(3-chloro-p-tolyl)-1,1-dimethylurea |
| CAS name: | N′-(3-chloro-4-methylphenyl)-N,N-dimethylurea |
| CAS Reg. No.: | 15545-48-9 |
| Formula: | C10H13ClN2O |
| Activity: | herbicides (phenylurea) |
| Notes: | The name “chlortoluron” is approved by the Weed Science Society of America, and is also approved in France and in China (绿麦隆). |
| Structure: |  |
| Pronunciation: | klor-ō-tǒl-ūr-ǒn Guide to British pronunciation |
| InChIKey: | JXCGFZXSOMJFOA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H13ClN2O/c1-7-4-5-8(6-9(7)11)12-10(14)13(2)3/h4-6H,1-3H3,(H,12,14) |