| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2-(4-chlorophenyl)-3-ethyl-5-oxo-2,5-dihydropyridazine-4-carboxylic acid |
| IUPAC name: | 2-(4-chlorophenyl)-3-ethyl-5-oxo-2,5-dihydropyridazine-4-carboxylic acid 1979 Rules: 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylic acid |
| CAS name: | 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid |
| CAS Reg. No.: | 129025-54-3 |
| Formula: | C13H11ClN2O3 |
| Activity: | plant growth regulators (gametocide) |
| Notes: | Derivatives include clofencet-potassium [82697-71-0]. |
| Structure: | |
| Pronunciation: | klō-fěn-sět Guide to British pronunciation |
| InChIKey: | PIZCXVUFSNPNON-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H11ClN2O3/c1-2-10-12(13(18)19)11(17)7-15-16(10)9-5-3-8(14)4-6-9/h3-7H,2H2,1H3,(H,18,19) |
A data sheet from the Compendium of Pesticide Common Names