| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | rac-N-[5-chloro-4-[(R)-(4-chlorophenyl)(cyano)methyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| IUPAC name: | 5′-chloro-4′-[(αRS)-4-chloro-α-cyanobenzyl]-2-hydroxy-3,5-diiodo-2′-methylbenzanilide 1979 Rules: (RS)-5′-chloro-4′-(4-chloro-α-cyanobenzyl)-3,5-diiodo-2′-methylsalicylanilide |
| CAS name: | N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| CAS Reg. No.: | 57808-65-8 |
| Formula: | C22H14Cl2I2N2O2 |
| Activity: | acaricides (salicylanilide) insecticides (salicylanilide) |
| Notes: | There is no ISO common name for this substance; the name “closantel” is approved by the World Health Organization. |
| Structure: | |
| Pronunciation: | klō-san-těl Guide to British pronunciation |
| InChIKey: | JMPFSEBWVLAJKM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C22H14Cl2I2N2O2/c1-11-6-15(17(10-27)12-2-4-13(23)5-3-12)18(24)9-20(11)28-22(30)16-7-14(25)8-19(26)21(16)29/h2-9,17,29H,1H3,(H,28,30) |
A data sheet from the Compendium of Pesticide Common Names