| Approval: | ISO |
|---|---|
| IUPAC PIN: | [4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
| IUPAC name: | [4-chloro-2-(hydroxymethyl)phenoxy]acetic acid 1979 Rules: [(4-chloro-α-hydroxy-o-tolyl)oxy]acetic acid |
| CAS name: | 2-[4-chloro-2-(hydroxymethyl)phenoxy]acetic acid |
| CAS Reg. No.: | 6386-63-6 |
| Formula: | C9H9ClO4 |
| Activity: | plant growth regulators (auxin) |
| Notes: | Derivatives include cloxyfonac-sodium [32791-87-0]. The name “座果酸” is approved in China for cloxyfonac and for cloxyfonac-sodium. |
| Structure: | |
| Pronunciation: | klǒk-sē-fō-nǎk Guide to British pronunciation |
| InChIKey: | ZJRUTGDCLVIVRD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9ClO4/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13/h1-3,11H,4-5H2,(H,12,13) |
A data sheet from the Compendium of Pesticide Common Names