| Approval: | WSSA |
|---|---|
| IUPAC PIN: | (Ξ)-N′-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride |
| IUPAC name: | (EZ)-N′-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidoyl chloride |
| CAS name: | N′-(3,4-dichlorophenyl)-N,N-dimethylcarbamimidic chloride |
| CAS Reg. No.: | 6022-33-9 |
| Formula: | C9H9Cl3N2 |
| Activity: | herbicides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “CPMF” is approved by the Weed Science Society of America. |
| Structure: | |
| Pronunciation: | sē pē ěm ěf Guide to British pronunciation |
| InChIKey: | WKQYAIDXQNGNIQ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9Cl3N2/c1-14(2)9(12)13-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names