| Approval: | WSSA |
|---|---|
| IUPAC PIN: | rac-(2R)-1-chloropropan-2-yl (3-chlorophenyl)carbamate |
| IUPAC name: | (2RS)-1-chloropropan-2-yl (3-chlorophenyl)carbamate 1979 Rules: (RS)-2-chloro-1-methylethyl 3-chlorocarbanilate |
| CAS name: | 2-chloro-1-methylethyl N-(3-chlorophenyl)carbamate |
| CAS Reg. No.: | 2150-32-5 |
| Formula: | C10H11Cl2NO2 |
| Activity: | herbicides (carbamate) |
| Notes: | There is no ISO common name for this substance; the name “CPPC” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | sē pē pē sē Guide to British pronunciation |
| InChIKey: | WLKSPGHQGFFKGE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H11Cl2NO2/c1-7(6-11)15-10(14)13-9-4-2-3-8(12)5-9/h2-5,7H,6H2,1H3,(H,13,14) |