| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | (2E)-N-ethyl-N-(2-methylphenyl)but-2-enamide |
| IUPAC name: | (2E)-N-ethyl-2′-methylbut-2-enanilide 1979 Rules: N-ethyl-2′-methylcrotonanilide |
| CAS name: | (2E)-N-ethyl-N-(2-methylphenyl)-2-butenamide |
| CAS Reg. No.: | 483-63-6 |
| Formula: | C13H17NO |
| Activity: | acaricides (unclassified) insecticides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “crotamiton” is approved by the World Health Organization. |
| Structure: | |
| Pronunciation: | krō-tǎm-ǐ-tǒn Guide to British pronunciation |
| InChIKey: | DNTGGZPQPQTDQF-XBXARRHUSA-N |
| InChI: | InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4+ |
A data sheet from the Compendium of Pesticide Common Names