| Approval: | China |
|---|---|
| IUPAC PIN: | hexadecyl cyclopropanecarboxylate |
| IUPAC name: | hexadecyl cyclopropanecarboxylate |
| CAS name: | hexadecyl cyclopropanecarboxylate |
| CAS Reg. No.: | 54460-46-7 |
| Formula: | C20H38O2 |
| Activity: | acaricides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “cycloprate” (环螨酯) is approved in China. |
| Structure: | |
| Pronunciation: | sī-klō-prāt Guide to British pronunciation |
| InChIKey: | NSCKKHGFMYTPBG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-20(21)19-16-17-19/h19H,2-18H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names