Approval: | ISO |
---|---|
IUPAC PIN: | (Ξ)-cyano(3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
IUPAC name: | (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
CAS name: | cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
CAS Reg. No.: | 52315-07-8 |
Formula: | C22H19Cl2NO3 |
Activity: | acaricides (pyrethroid) insecticides (pyrethroid) |
Notes: | Some subsets of isomers of this substance have their own ISO common names; see alpha-cypermethrin [67375-30-8], beta-cypermethrin [65731-84-2], theta-cypermethrin [71697-59-1] and zeta-cypermethrin [1315501-18-8]. |
Structure: | |
Pronunciation: | sī-per-mēth-rǐn Guide to British pronunciation |
InChIKey: | KAATUXNTWXVJKI-UHFFFAOYSA-N |
InChI: | InChI=1S/C22H19Cl2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names