| Approval: | ISO preferred name |
|---|---|
| IUPAC PIN: | (4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene |
| IUPAC name: | (R)-4-isopropenyl-1-methylcyclohexene or p-mentha-1,8-diene |
| CAS name: | (4R)-1-methyl-4-(1-methylethenyl)cyclohexene |
| CAS Reg. No.: | 5989-27-5 |
| Formula: | C10H16 |
| Activity: | insecticides (botanical) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
| Structure: | |
| Pronunciation: | dē lǐm-ō-nēn Guide to British pronunciation |
| InChIKey: | XMGQYMWWDOXHJM-JTQLQIEISA-N |
| InChI: | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names