| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 2,3,6-trichlorobenzoic acid—N-methylmethanamine (1/1) |
| IUPAC name: | 2,3,6-trichlorobenzoic acid - dimethylamine (1:1) or dimethylammonium 2,3,6-trichlorobenzoate |
| CAS name: | 2,3,6-trichlorobenzoic acid compound with N-methylmethanamine (1:1) |
| CAS Reg. No.: | 3426-62-8 |
| Formula: | C9H10Cl3NO2 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of 2,3,6-TBA [50-31-7]. |
| Structure: |  |
| Pronunciation: | too thrē sǐks tē bē ā dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | QSFRJEUITMJQCX-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H3Cl3O2.C2H7N/c8-3-1-2-4(9)6(10)5(3)7(11)12;1-3-2/h1-2H,(H,11,12);3H,1-2H3 |