Status: | modified ISO 1750 (provisionally approved) |
---|---|
IUPAC PIN: | 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid—N,N-diethylethan-1-amine (1/1) |
IUPAC name: | 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylic acid - triethylamine (1:1) or triethylammonium 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
CAS name: | 6-amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylic acid compound with N,N-diethylethanamine (1:1) |
CAS Reg. No.: | 858956-32-8 |
Formula: | C14H23ClN4O2 |
Activity: | herbicides (pyrimidinecarboxylic acid) |
Notes: | This substance is a derivative of aminocyclopyrachlor [858956-08-8]. |
Structure: | |
Pronunciation: | a-mē-nō-sī-clō-pīr-a-klor trī-ē-thīl-a-mōn-ē-am Guide to British pronunciation |
InChIKey: | OPXYSCVSOMBXJI-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H8ClN3O2.C6H15N/c9-4-5(8(13)14)11-7(3-1-2-3)12-6(4)10;1-4-7(5-2)6-3/h3H,1-2H2,(H,13,14)(H2,10,11,12);4-6H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names