Approval: | ISO common name not required |
---|---|
IUPAC PIN: | ammonium (naphthalen-1-yl)acetate |
IUPAC name: | ammonium 1-naphthylacetate |
CAS name: | ammonium 1-naphthaleneacetate |
CAS Reg. No.: | 25545-89-5 |
Formula: | C12H13NO2 |
Activity: | plant growth regulators (auxin) |
Notes: | This substance is a derivative of 1-naphthaleneacetic acid [86-87-3]. |
Structure: | |
Pronunciation: | a-mōn-ē-am wǔn nǎf-tha-lēn-ǎs-ǐ-tāt Guide to British pronunciation |
InChIKey: | DFJCVWWLYPHXNW-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H10O2.H3N/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);1H3 |
A data sheet from the Compendium of Pesticide Common Names