| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | ammonium (naphthalen-1-yl)acetate |
| IUPAC name: | ammonium 1-naphthylacetate |
| CAS name: | ammonium 1-naphthaleneacetate |
| CAS Reg. No.: | 25545-89-5 |
| Formula: | C12H13NO2 |
| Activity: | plant growth regulators (auxin) |
| Notes: | This substance is a derivative of 1-naphthaleneacetic acid [86-87-3]. |
| Structure: | |
| Pronunciation: | a-mōn-ē-am wǔn nǎf-tha-lēn-ǎs-ǐ-tāt Guide to British pronunciation |
| InChIKey: | DFJCVWWLYPHXNW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H10O2.H3N/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10;/h1-7H,8H2,(H,13,14);1H3 |
A data sheet from the Compendium of Pesticide Common Names