| Approval: | Parent – ISO |
|---|---|
| IUPAC name: | S,S′-[2-(dimethylamino)trimethylene] bis(thiocarbamate) hydrochloride |
| CAS name: | S,S′-[2-(dimethylamino)-1,3-propanediyl] dicarbamothioate hydrochloride (1:1) |
| CAS Reg. No.: | 15263-52-2 |
| Formula: | C7H16ClN3O2S2 |
| Activity: | insecticides (nereistoxin analogue) |
| Notes: | This substance is a derivative of cartap [15263-53-3]. |
| Structure: | |
| Pronunciation: | kar-tǎp hī-drō-klor-ǐd Guide to British pronunciation |
| InChIKey: | MSHXTAQSSIEBQS-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H15N3O2S2.ClH/c1-10(2)5(3-13-6(8)11)4-14-7(9)12;/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12);1H |
A data sheet from the Compendium of Pesticide Common Names