| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | ammonium (2,3,6-trichlorophenyl)acetate |
| IUPAC name: | ammonium (2,3,6-trichlorophenyl)acetate |
| CAS name: | ammonium 2,3,6-trichlorobenzeneacetate |
| CAS Reg. No.: | 53404-90-3 |
| Formula: | C8H8Cl3NO2 |
| Activity: | herbicides (phenylcarboxylic acid) |
| Notes: | This substance is a derivative of chlorfenac [85-34-7]. The name “fenac ammonium” is used in Canada and the USA. |
| Structure: |  |
| Pronunciation: | klor-fěn-ǎk a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | DZRJBVFMFCMALE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H5Cl3O2.H3N/c9-5-1-2-6(10)8(11)4(5)3-7(12)13;/h1-2H,3H2,(H,12,13);1H3 |