| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | sodium (2,3,6-trichlorophenyl)acetate |
| IUPAC name: | sodium (2,3,6-trichlorophenyl)acetate |
| CAS name: | sodium 2,3,6-trichlorobenzeneacetate |
| CAS Reg. No.: | 2439-00-1 |
| Formula: | C8H4Cl3NaO2 |
| Activity: | herbicides (phenylcarboxylic acid) |
| Notes: | This substance is a derivative of chlorfenac [85-34-7]. The name “fenac sodium” is used in Canada and the USA. |
| Structure: |  |
| Pronunciation: | klor-fěn-ǎk sō-dē-am Guide to British pronunciation |
| InChIKey: | YPWJVPXHSDMPQB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C8H5Cl3O2.Na/c9-5-1-2-6(10)8(11)4(5)3-7(12)13;/h1-2H,3H2,(H,12,13);/q;+1/p-1 |