| Approval | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-methyl (2R)-2-chloro-3-(4-chlorophenyl)propanoate |
| IUPAC name: | methyl (RS)-2-chloro-3-(4-chlorophenyl)propionate |
| CAS name: | methyl α,4-dichlorobenzenepropanoate |
| CAS Reg. No.: | 14437-17-3 |
| Formula: | C10H10Cl2O2 |
| Activity: | herbicides (phenylcarboxylic acid) |
| Notes: | This substance is a derivative of chlorfenprop [59604-11-4]. The name “chlorfenprop-methyl” was formerly approved by ISO for this substance, but this was replaced by the name “chlorfenprop” for the acid. The name “chlorphenprop-methyl” (燕麦酯) is approved in China. |
| Structure: |  |
| Pronunciation: | klor-fěn-prǒp mē-thīl Guide to British pronunciation |
| InChIKey: | YJKIALIXRCSISK-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H10Cl2O2/c1-14-10(13)9(12)6-7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |