| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-methyl (9R)-2-chloro-9H-fluorene-9-carboxylate |
| IUPAC name: | methyl (RS)-2-chlorofluorene-9-carboxylate |
| CAS name: | methyl 2-chloro-9H-fluorene-9-carboxylate |
| CAS Reg. No.: | 22909-50-8 |
| Formula: | C15H11ClO2 |
| Activity: | plant growth regulators (morphactin) |
| Notes: | This substance is a derivative of chlorfluren [24539-66-0]. |
| Structure: | |
| Pronunciation: | klor-flūr-ěn mē-thīl Guide to British pronunciation |
| InChIKey: | DFYPVJHFCVSDEV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H11ClO2/c1-18-15(17)14-12-5-3-2-4-10(12)11-7-6-9(16)8-13(11)14/h2-8,14H,1H3 |
A data sheet from the Compendium of Pesticide Common Names