| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 2,3,5,6-tetrachloro-4-(methoxycarbonyl)benzoic acid |
| IUPAC name: | 2,3,5,6-tetrachloro-4-(methoxycarbonyl)benzoic acid or methyl hydrogen tetrachloroterephthalate |
| CAS name: | 1-methyl hydrogen 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid |
| CAS Reg. No.: | 887-54-7 |
| Formula: | C9H4Cl4O4 |
| Activity: | herbicides (benzoic acid) |
| Notes: | This substance is a derivative of chlorthal [2136-79-0]. |
| Structure: | |
| Pronunciation: | klor-thǎl mǒn-ō-mē-thīl Guide to British pronunciation |
| InChIKey: | SXINVWXSZUQKSW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H4Cl4O4/c1-17-9(16)3-6(12)4(10)2(8(14)15)5(11)7(3)13/h1H3,(H,14,15) |
A data sheet from the Compendium of Pesticide Common Names