| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | methyl [(5-chloroquinolin-8-yl)oxy]acetate |
| IUPAC name: | methyl [(5-chloro-8-quinolyl)oxy]acetate |
| CAS name: | methyl 2-[(5-chloro-8-quinolinyl)oxy]acetate |
| CAS Reg. No.: | 4367-49-1 |
| Formula: | C12H10ClNO3 |
| Activity: | herbicide safeners |
| Notes: | This substance is a derivative of cloquintocet [88349-88-6]. |
| Structure: | |
| Pronunciation: | klō-kwǐn-tō-sět mē-thīl Guide to British pronunciation |
| InChIKey: | NDQZMBNEHYSVPL-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H10ClNO3/c1-16-11(15)7-17-10-5-4-9(13)8-3-2-6-14-12(8)10/h2-6H,7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names