| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-heptan-2-yl [(5-chloroquinolin-8-yl)oxy]acetate |
| IUPAC name: | (RS)-1-methylhexyl [(5-chloro-8-quinolyl)oxy]acetate |
| CAS name: | 1-methylhexyl 2-[(5-chloro-8-quinolinyl)oxy]acetate |
| CAS Reg. No.: | 99607-70-2 |
| Formula: | C18H22ClNO3 |
| Activity: | herbicide safeners |
| Notes: | This substance is a derivative of cloquintocet [88349-88-6]. The name “cloquintocet-mexyl” (解草酯) is approved in China, but is incorrectly spelled “cloquitocet-mexyl” in GB 4839-2009 Chinese common names for pesticides. |
| Structure: |  |
| Pronunciation: | klō-kwǐn-tō-sět měks-īl Guide to British pronunciation |
| InChIKey: | COYBRKAVBMYYSF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H22ClNO3/c1-3-4-5-7-13(2)23-17(21)12-22-16-10-9-15(19)14-8-6-11-20-18(14)16/h6,8-11,13H,3-5,7,12H2,1-2H3 |