| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 1-methyl-4-phenylpyridin-1-ium chloride |
| IUPAC name: | 1-methyl-4-phenylpyridinium chloride |
| CAS name: | 1-methyl-4-phenylpyridinium chloride |
| CAS Reg. No.: | 39794-99-5 |
| Formula: | C12H12ClN |
| Activity: | herbicides (quaternary ammonium) |
| Notes: | This substance is a derivative of cyperquat [48134-75-4]. |
| Structure: | |
| Pronunciation: | sī-per-kwǒt klor-īd Guide to British pronunciation |
| InChIKey: | LMGBDZJLZIPJPZ-UHFFFAOYSA-M |
| InChI: | InChI=1S/C12H12N.ClH/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10H,1H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names