| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-2-butoxyethyl (2R)-2-(2,4-dichlorophenoxy)propanoate |
| IUPAC name: | 2-butoxyethyl (2RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS name: | 2-butoxyethyl 2-(2,4-dichlorophenoxy)propanoate |
| CAS Reg. No.: | 53404-31-2 |
| Formula: | C15H20Cl2O4 |
| Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. |
| Structure: | |
| Pronunciation: | dī-klor-prǒp bū-tō-tīl Guide to British pronunciation |
| InChIKey: | NCMJQZVNCFTQPG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H20Cl2O4/c1-3-4-7-19-8-9-20-15(18)11(2)21-14-6-5-12(16)10-13(14)17/h5-6,10-11H,3-4,7-9H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names