| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (2Ξ)-2-ethylhexyl (2Ξ)-2-(2,4-dichlorophenoxy)propanoate |
| IUPAC name: | (2RS)-2-ethylhexyl (2RS)-2-(2,4-dichlorophenoxy)propionate |
| CAS name: | 2-ethylhexyl 2-(2,4-dichlorophenoxy)propanoate |
| CAS Reg. No.: | 79270-78-3 |
| Formula: | C17H24Cl2O3 |
| Activity: | herbicides (phenoxypropionic) plant growth regulators (auxin) |
| Notes: | This substance is a derivative of dichlorprop [120-36-5]. This substance was previously known as dichlorprop-2-ethylhexyl. The (+)-enantiomer of this substance has the ISO common name dichlorprop-P-etexyl [865363-39-9]. |
| Structure: |  |
| Pronunciation: | dī-klor-prǒp ē-těks-īl Guide to British pronunciation |
| InChIKey: | CEEDFYRUPAWDOU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C17H24Cl2O3/c1-4-6-7-13(5-2)11-21-17(20)12(3)22-16-9-8-14(18)10-15(16)19/h8-10,12-13H,4-7,11H2,1-3H3 |