| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 6,7-dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-5,8-diium dichloride |
| IUPAC name: | 9,10-dihydro-8a,10a-diazoniaphenanthrene dichloride or 6,7-dihydrodipyrido[1,2-a:2′,1′-c]pyrazine-5,8-diium dichloride or 1,1′-ethylene-2,2′-bipyridyldiylium dichloride |
| CAS name: | 6,7-dihydrodipyrido[1,2-a:2′,1′-c]pyrazinediium dichloride |
| CAS Reg. No.: | 4032-26-2 |
| Formula: | C12H12Cl2N2 |
| Activity: | herbicides (quaternary ammonium) |
| Notes: | This substance is a derivative of diquat [2764-72-9]. The name “deiquat dichloride” is used in Germany. |
| Structure: | |
| Pronunciation: | dī-kwǒt dī-klor-īd Guide to British pronunciation |
| InChIKey: | SKYNPRKUXHXZFJ-UHFFFAOYSA-L |
| InChI: | InChI=1S/C12H12N2.2ClH/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1;;/h1-8H,9-10H2;2*1H/q+2;;/p-2 |
A data sheet from the Compendium of Pesticide Common Names